C23H19F5N4O3 — CID 139313240
(4R,6S)-4-amino-11-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-2,8-diazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one (PubChem CID 139313240) has the molecular formula C23H19F5N4O3 and a molecular weight of 494.42 g/mol. Its IUPAC name is (4R,6S)-4-amino-11-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-2,8-diazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one.
| Compound Name | (4R,6S)-4-amino-11-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-2,8-diazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one |
|---|---|
| PubChem CID | 139313240 |
| Molecular Formula | C23H19F5N4O3 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | (4R,6S)-4-amino-11-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-2,8-diazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one |
| SMILES | N[C@@H]1C[C@H]2Cn3c(cc(OCc4cc(F)c(Oc5ccnc(C(F)(F)F)c5)c(F)c4)cc3=O)N2C1 |
| InChI | InChI=1S/C23H19F5N4O3/c24-17-3-12(4-18(25)22(17)35-15-1-2-30-19(6-15)23(26,27)28)11-34-16-7-20-31-9-13(29)5-14(31)10-32(20)21(33)8-16/h1-4,6-8,13-14H,5,9-11,29H2/t13-,14+/m1/s1 |
| InChIKey | OXJGOXJCJLDEED-KGLIPLIRSA-N |
| XLogP | 3.83 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |