C13H13NOS2 — CID 139314965
2-[methyl(thieno[3,2-b][1]benzothiol-6-yl)amino]ethanol (PubChem CID 139314965) has the molecular formula C13H13NOS2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 2-[methyl(thieno[3,2-b][1]benzothiol-6-yl)amino]ethanol.
| Compound Name | 2-[methyl(thieno[3,2-b][1]benzothiol-6-yl)amino]ethanol |
|---|---|
| PubChem CID | 139314965 |
| Molecular Formula | C13H13NOS2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-[methyl(thieno[3,2-b][1]benzothiol-6-yl)amino]ethanol |
| SMILES | CN(CCO)c1ccc2c(c1)sc1ccsc12 |
| InChI | InChI=1S/C13H13NOS2/c1-14(5-6-15)9-2-3-10-12(8-9)17-11-4-7-16-13(10)11/h2-4,7-8,15H,5-6H2,1H3 |
| InChIKey | CYHCTMSNKYMKDE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |