C17H24N2O3 — CID 139315380
2-(anilinocarbamoyl)-5,5-dimethylcycloheptane-1-carboxylic acid (PubChem CID 139315380) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(anilinocarbamoyl)-5,5-dimethylcycloheptane-1-carboxylic acid.
| Compound Name | 2-(anilinocarbamoyl)-5,5-dimethylcycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 139315380 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(anilinocarbamoyl)-5,5-dimethylcycloheptane-1-carboxylic acid |
| SMILES | CC1(C)CCC(C(=O)O)C(C(=O)NNc2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2)10-8-13(14(9-11-17)16(21)22)15(20)19-18-12-6-4-3-5-7-12/h3-7,13-14,18H,8-11H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | AHQIOZAHODCZDK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|