C14H25N — CID 139315492
2,6-ditert-butyl-2-methyl-3H-pyridine (PubChem CID 139315492) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 2,6-ditert-butyl-2-methyl-3H-pyridine.
| Compound Name | 2,6-ditert-butyl-2-methyl-3H-pyridine |
|---|---|
| PubChem CID | 139315492 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 2,6-ditert-butyl-2-methyl-3H-pyridine |
| SMILES | CC(C)(C)C1=NC(C)(C(C)(C)C)CC=C1 |
| InChI | InChI=1S/C14H25N/c1-12(2,3)11-9-8-10-14(7,15-11)13(4,5)6/h8-9H,10H2,1-7H3 |
| InChIKey | APBZDVYMEYJJQK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |