C20H37N — CID 88928035
(5Z)-6,10-dimethyl-N-(2,3,3-trimethylbutan-2-yl)undeca-5,9-dien-4-imine (PubChem CID 88928035) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is (5Z)-6,10-dimethyl-N-(2,3,3-trimethylbutan-2-yl)undeca-5,9-dien-4-imine.
| Compound Name | (5Z)-6,10-dimethyl-N-(2,3,3-trimethylbutan-2-yl)undeca-5,9-dien-4-imine |
|---|---|
| PubChem CID | 88928035 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | (5Z)-6,10-dimethyl-N-(2,3,3-trimethylbutan-2-yl)undeca-5,9-dien-4-imine |
| SMILES | CCCC(/C=C(/C)CCC=C(C)C)=N\C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H37N/c1-10-12-18(21-20(8,9)19(5,6)7)15-17(4)14-11-13-16(2)3/h13,15H,10-12,14H2,1-9H3/b17-15-,21-18+ |
| InChIKey | QITMQFBYJFZMOW-GMTUMFJYSA-N |
| XLogP | 6.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|