C32H50O5 — CID 139318202
[(4R,6R)-6-[(3S,7S,8S,9R,10R,13R,14S)-9-formyl-3,7-dihydroxy-4,4,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-en-4-yl] acetate (PubChem CID 139318202) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is [(4R,6R)-6-[(3S,7S,8S,9R,10R,13R,14S)-9-formyl-3,7-dihydroxy-4,4,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-en-4-yl] acetate.
| Compound Name | [(4R,6R)-6-[(3S,7S,8S,9R,10R,13R,14S)-9-formyl-3,7-dihydroxy-4,4,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-en-4-yl] acetate |
|---|---|
| PubChem CID | 139318202 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | [(4R,6R)-6-[(3S,7S,8S,9R,10R,13R,14S)-9-formyl-3,7-dihydroxy-4,4,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-en-4-yl] acetate |
| SMILES | CC(=O)O[C@@H](C=C(C)C)C[C@@H](C)C1CC[C@@]2(C)[C@@H]3[C@@H](O)C=C4[C@@H](CC[C@H](O)C4(C)C)[C@]3(C=O)CC[C@]12C |
| InChI | InChI=1S/C32H50O5/c1-19(2)15-22(37-21(4)34)16-20(3)23-11-12-31(8)28-26(35)17-25-24(9-10-27(36)29(25,5)6)32(28,18-33)14-13-30(23,31)7/h15,17-18,20,22-24,26-28,35-36H,9-14,16H2,1-8H3/t20-,22+,23?,24-,26+,27+,28+,30-,31+,32-/m1/s1 |
| InChIKey | MSHVFIRVNSRRKB-WPJIZGPISA-N |
| XLogP | 6.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|