C51H62O6 — CID 76536594
[7-benzoyloxy-17-(4-benzoyloxy-6-methylhept-5-en-2-yl)-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 76536594) has the molecular formula C51H62O6 and a molecular weight of 771.05 g/mol. Its IUPAC name is [7-benzoyloxy-17-(4-benzoyloxy-6-methylhept-5-en-2-yl)-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [7-benzoyloxy-17-(4-benzoyloxy-6-methylhept-5-en-2-yl)-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 76536594 |
| Molecular Formula | C51H62O6 |
| Molecular Weight | 771.05 g/mol |
| Exact Mass | 770.45 |
| IUPAC Name | [7-benzoyloxy-17-(4-benzoyloxy-6-methylhept-5-en-2-yl)-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(C)=CC(CC(C)C1CCC2(C)C3C(OC(=O)c4ccccc4)C=C4C(CCC(OC(=O)c5ccccc5)C4(C)C)C3(C)CCC12C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C51H62O6/c1-33(2)30-38(55-45(52)35-18-12-9-13-19-35)31-34(3)39-26-27-51(8)44-42(56-46(53)36-20-14-10-15-21-36)32-41-40(49(44,6)28-29-50(39,51)7)24-25-43(48(41,4)5)57-47(54)37-22-16-11-17-23-37/h9-23,30,32,34,38-40,42-44H,24-29,31H2,1-8H3 |
| InChIKey | CBPYGZZVJLABTM-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.05 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|