C34H54O6 — CID 139318074
[(1R,9S,12E)-11-acetyloxy-10-formyl-6-[(2R)-4-hydroxy-6-methylhept-5-en-2-yl]-5,9,14,14-tetramethyl-15-tricyclo[11.4.0.05,9]heptadec-12-enyl] acetate (PubChem CID 139318074) has the molecular formula C34H54O6 and a molecular weight of 558.80 g/mol. Its IUPAC name is [(1R,9S,12E)-11-acetyloxy-10-formyl-6-[(2R)-4-hydroxy-6-methylhept-5-en-2-yl]-5,9,14,14-tetramethyl-15-tricyclo[11.4.0.05,9]heptadec-12-enyl] acetate.
| Compound Name | [(1R,9S,12E)-11-acetyloxy-10-formyl-6-[(2R)-4-hydroxy-6-methylhept-5-en-2-yl]-5,9,14,14-tetramethyl-15-tricyclo[11.4.0.05,9]heptadec-12-enyl] acetate |
|---|---|
| PubChem CID | 139318074 |
| Molecular Formula | C34H54O6 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | [(1R,9S,12E)-11-acetyloxy-10-formyl-6-[(2R)-4-hydroxy-6-methylhept-5-en-2-yl]-5,9,14,14-tetramethyl-15-tricyclo[11.4.0.05,9]heptadec-12-enyl] acetate |
| SMILES | CC(=O)OC1/C=C2\[C@H](CCCC3(C)C([C@H](C)CC(O)C=C(C)C)CC[C@@]3(C)C1C=O)CCC(OC(C)=O)C2(C)C |
| InChI | InChI=1S/C34H54O6/c1-21(2)17-26(38)18-22(3)27-14-16-34(9)29(20-35)30(39-23(4)36)19-28-25(11-10-15-33(27,34)8)12-13-31(32(28,6)7)40-24(5)37/h17,19-20,22,25-27,29-31,38H,10-16,18H2,1-9H3/b28-19+/t22-,25-,26?,27?,29?,30?,31?,33?,34+/m1/s1 |
| InChIKey | YRYWALDHJVVROH-BIEGFFSISA-N |
| XLogP | 6.99 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|