C30H50O4 — CID 139493257
(1E,3S,4R,5S,9R,13R,16S)-3,16-dihydroxy-8-[(E)-6-hydroxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyltricyclo[11.4.0.05,9]heptadec-1-ene-4-carbaldehyde (PubChem CID 139493257) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is (1E,3S,4R,5S,9R,13R,16S)-3,16-dihydroxy-8-[(E)-6-hydroxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyltricyclo[11.4.0.05,9]heptadec-1-ene-4-carbaldehyde.
| Compound Name | (1E,3S,4R,5S,9R,13R,16S)-3,16-dihydroxy-8-[(E)-6-hydroxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyltricyclo[11.4.0.05,9]heptadec-1-ene-4-carbaldehyde |
|---|---|
| PubChem CID | 139493257 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (1E,3S,4R,5S,9R,13R,16S)-3,16-dihydroxy-8-[(E)-6-hydroxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyltricyclo[11.4.0.05,9]heptadec-1-ene-4-carbaldehyde |
| SMILES | CC(C/C=C/C(C)(C)O)C1CC[C@@]2(C)[C@@H](C=O)[C@@H](O)/C=C3\[C@H](CCC[C@]12C)CC[C@H](O)C3(C)C |
| InChI | InChI=1S/C30H50O4/c1-20(10-8-15-27(2,3)34)22-14-17-30(7)24(19-31)25(32)18-23-21(11-9-16-29(22,30)6)12-13-26(33)28(23,4)5/h8,15,18-22,24-26,32-34H,9-14,16-17H2,1-7H3/b15-8+,23-18+/t20?,21-,22?,24+,25+,26+,29-,30+/m1/s1 |
| InChIKey | SPFFWQSXHNQXKH-OHRHSILRSA-N |
| XLogP | 5.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|