C13H26S — CID 139320332
1-(2,2-dimethylpropylsulfanyl)-4,4-dimethyl-3-methylidenepentane (PubChem CID 139320332) has the molecular formula C13H26S and a molecular weight of 214.42 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethyl-3-methylidenepentane.
| Compound Name | 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethyl-3-methylidenepentane |
|---|---|
| PubChem CID | 139320332 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethyl-3-methylidenepentane |
| SMILES | C=C(CCSCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26S/c1-11(13(5,6)7)8-9-14-10-12(2,3)4/h1,8-10H2,2-7H3 |
| InChIKey | MFPIZWXINGCNLY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|