C27H28N6O2 — CID 139324782
4-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]-2-pyridinyl]-N-(oxan-4-yl)benzamide (PubChem CID 139324782) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 4-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]-2-pyridinyl]-N-(oxan-4-yl)benzamide.
| Compound Name | 4-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]-2-pyridinyl]-N-(oxan-4-yl)benzamide |
|---|---|
| PubChem CID | 139324782 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 4-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]-2-pyridinyl]-N-(oxan-4-yl)benzamide |
| SMILES | Nc1ccc(-c2ccc(C(=O)NC3CCOCC3)cc2)nc1N(N)Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C27H28N6O2/c28-23-8-10-25(19-4-6-20(7-5-19)27(34)31-22-11-14-35-15-12-22)32-26(23)33(29)17-18-3-9-24-21(16-18)2-1-13-30-24/h1-10,13,16,22H,11-12,14-15,17,28-29H2,(H,31,34) |
| InChIKey | OGKSLOKIWMRGIT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|