C25H31N7O2+2 — CID 163739377
[2-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]-2-pyridinyl]-3-azaniumylideneprop-1-enyl]-[2-(oxan-2-yloxy)ethenyl]azanium (PubChem CID 163739377) has the molecular formula C25H31N7O2+2 and a molecular weight of 461.57 g/mol. Its IUPAC name is [2-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]-2-pyridinyl]-3-azaniumylideneprop-1-enyl]-[2-(oxan-2-yloxy)ethenyl]azanium.
| Compound Name | [2-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]-2-pyridinyl]-3-azaniumylideneprop-1-enyl]-[2-(oxan-2-yloxy)ethenyl]azanium |
|---|---|
| PubChem CID | 163739377 |
| Molecular Formula | C25H31N7O2+2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | [2-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]-2-pyridinyl]-3-azaniumylideneprop-1-enyl]-[2-(oxan-2-yloxy)ethenyl]azanium |
| SMILES | Nc1ccc(C(C=[NH2+])=C[NH2+]C=COC2CCCCO2)nc1N(N)Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C25H29N7O2/c26-15-20(16-29-11-13-34-24-5-1-2-12-33-24)23-9-7-21(27)25(31-23)32(28)17-18-6-8-22-19(14-18)4-3-10-30-22/h3-4,6-11,13-16,24,26,29H,1-2,5,12,17,27-28H2/p+2 |
| InChIKey | LGKZVYSXMGQHIY-UHFFFAOYSA-P |
| XLogP | 0.84 |
| TPSA | 141.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|