C22H22N6S — CID 155149925
2-[amino(quinolin-6-ylmethyl)amino]-6-[3-(methylsulfanylamino)phenyl]pyridin-3-amine (PubChem CID 155149925) has the molecular formula C22H22N6S and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-[amino(quinolin-6-ylmethyl)amino]-6-[3-(methylsulfanylamino)phenyl]pyridin-3-amine.
| Compound Name | 2-[amino(quinolin-6-ylmethyl)amino]-6-[3-(methylsulfanylamino)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 155149925 |
| Molecular Formula | C22H22N6S |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-[amino(quinolin-6-ylmethyl)amino]-6-[3-(methylsulfanylamino)phenyl]pyridin-3-amine |
| SMILES | CSNc1cccc(-c2ccc(N)c(N(N)Cc3ccc4ncccc4c3)n2)c1 |
| InChI | InChI=1S/C22H22N6S/c1-29-27-18-6-2-4-17(13-18)21-10-8-19(23)22(26-21)28(24)14-15-7-9-20-16(12-15)5-3-11-25-20/h2-13,27H,14,23-24H2,1H3 |
| InChIKey | LLNGMVSOCTXANB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|