C27H30FN6P — CID 175621659
3-[amino(quinolin-6-ylmethyl)amino]-5-[3-fluoro-4-[methyl-(3-methylcyclopentyl)phosphanyl]phenyl]pyrazin-2-amine (PubChem CID 175621659) has the molecular formula C27H30FN6P and a molecular weight of 488.55 g/mol. Its IUPAC name is 3-[amino(quinolin-6-ylmethyl)amino]-5-[3-fluoro-4-[methyl-(3-methylcyclopentyl)phosphanyl]phenyl]pyrazin-2-amine.
| Compound Name | 3-[amino(quinolin-6-ylmethyl)amino]-5-[3-fluoro-4-[methyl-(3-methylcyclopentyl)phosphanyl]phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 175621659 |
| Molecular Formula | C27H30FN6P |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 3-[amino(quinolin-6-ylmethyl)amino]-5-[3-fluoro-4-[methyl-(3-methylcyclopentyl)phosphanyl]phenyl]pyrazin-2-amine |
| SMILES | CC1CCC(P(C)c2ccc(-c3cnc(N)c(N(N)Cc4ccc5ncccc5c4)n3)cc2F)C1 |
| InChI | InChI=1S/C27H30FN6P/c1-17-5-8-21(12-17)35(2)25-10-7-20(14-22(25)28)24-15-32-26(29)27(33-24)34(30)16-18-6-9-23-19(13-18)4-3-11-31-23/h3-4,6-7,9-11,13-15,17,21H,5,8,12,16,30H2,1-2H3,(H2,29,32) |
| InChIKey | NPTHAAUBGLNMEK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|