C22H25N9O2 — CID 143578639
2-[4-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]pyrazin-2-yl]pyrazol-1-yl]-N-oxopropanamide;ethane (PubChem CID 143578639) has the molecular formula C22H25N9O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-[4-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]pyrazin-2-yl]pyrazol-1-yl]-N-oxopropanamide;ethane.
| Compound Name | 2-[4-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]pyrazin-2-yl]pyrazol-1-yl]-N-oxopropanamide;ethane |
|---|---|
| PubChem CID | 143578639 |
| Molecular Formula | C22H25N9O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2-[4-[5-amino-6-[amino(quinolin-6-ylmethyl)amino]pyrazin-2-yl]pyrazol-1-yl]-N-oxopropanamide;ethane |
| SMILES | CC.CC(C(=O)N=O)n1cc(-c2cnc(N)c(N(N)Cc3ccc4ncccc4c3)n2)cn1 |
| InChI | InChI=1S/C20H19N9O2.C2H6/c1-12(20(30)27-31)29-11-15(8-25-29)17-9-24-18(21)19(26-17)28(22)10-13-4-5-16-14(7-13)3-2-6-23-16;1-2/h2-9,11-12H,10,22H2,1H3,(H2,21,24);1-2H3 |
| InChIKey | IKHXHRJJTLNGAG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 158.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|