C23H24N5O2P — CID 175621692
[4-[5-amino-6-(1-quinolin-6-ylethylamino)pyrazin-2-yl]phenyl]methyl-methylphosphinic acid (PubChem CID 175621692) has the molecular formula C23H24N5O2P and a molecular weight of 433.45 g/mol. Its IUPAC name is [4-[5-amino-6-(1-quinolin-6-ylethylamino)pyrazin-2-yl]phenyl]methyl-methylphosphinic acid.
| Compound Name | [4-[5-amino-6-(1-quinolin-6-ylethylamino)pyrazin-2-yl]phenyl]methyl-methylphosphinic acid |
|---|---|
| PubChem CID | 175621692 |
| Molecular Formula | C23H24N5O2P |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [4-[5-amino-6-(1-quinolin-6-ylethylamino)pyrazin-2-yl]phenyl]methyl-methylphosphinic acid |
| SMILES | CC(Nc1nc(-c2ccc(CP(C)(=O)O)cc2)cnc1N)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C23H24N5O2P/c1-15(18-9-10-20-19(12-18)4-3-11-25-20)27-23-22(24)26-13-21(28-23)17-7-5-16(6-8-17)14-31(2,29)30/h3-13,15H,14H2,1-2H3,(H2,24,26)(H,27,28)(H,29,30) |
| InChIKey | DRJMASWMDJNBPB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|