About oxido(oxo)azanium;2H-tetrazole;iodide
oxido(oxo)azanium;2H-tetrazole;iodide (PubChem CID 139326837) has the molecular formula CH3IN5O2-
and a molecular weight of 243.97 g/mol. Its IUPAC name is oxido(oxo)azanium;2H-tetrazole;iodide.
Molecular Properties
| Compound Name | oxido(oxo)azanium;2H-tetrazole;iodide |
| PubChem CID | 139326837 |
| Molecular Formula | CH3IN5O2- |
| Molecular Weight | 243.97 g/mol |
| Exact Mass | 243.93 |
| IUPAC Name | oxido(oxo)azanium;2H-tetrazole;iodide |
| SMILES | O=[NH+][O-].[I-].c1nn[nH]n1 |
| InChI | InChI=1S/CH2N4.HI.HNO2/c1-2-4-5-3-1;;2-1-3/h1H,(H,2,3,4,5);1H;1H/p-1 |
| InChIKey | GQHBNRLIHRKBIV-UHFFFAOYSA-M |
| XLogP | -5.47 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.97 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze oxido(oxo)azanium;2H-tetrazole;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido(oxo)azanium;2H-tetrazole;iodide?
The IUPAC name of oxido(oxo)azanium;2H-tetrazole;iodide (CID 139326837) is oxido(oxo)azanium;2H-tetrazole;iodide.
What is the SMILES notation for oxido(oxo)azanium;2H-tetrazole;iodide?
The canonical SMILES for oxido(oxo)azanium;2H-tetrazole;iodide is O=[NH+][O-].[I-].c1nn[nH]n1.
What is the InChIKey of oxido(oxo)azanium;2H-tetrazole;iodide?
The InChIKey is GQHBNRLIHRKBIV-UHFFFAOYSA-M. The full InChI is InChI=1S/CH2N4.HI.HNO2/c1-2-4-5-3-1;;2-1-3/h1H,(H,2,3,4,5);1H;1H/p-1.
What are the key properties of oxido(oxo)azanium;2H-tetrazole;iodide?
oxido(oxo)azanium;2H-tetrazole;iodide has a molecular weight of 243.97 g/mol, XLogP of -5.47, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxido(oxo)azanium;2H-tetrazole;iodide is sourced from PubChem (CID 139326837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).