C3H6N8O3 — CID 174907655
nitramide;1,2,5-oxadiazole;2H-tetrazole (PubChem CID 174907655) has the molecular formula C3H6N8O3 and a molecular weight of 202.13 g/mol. Its IUPAC name is nitramide;1,2,5-oxadiazole;2H-tetrazole.
| Compound Name | nitramide;1,2,5-oxadiazole;2H-tetrazole |
|---|---|
| PubChem CID | 174907655 |
| Molecular Formula | C3H6N8O3 |
| Molecular Weight | 202.13 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | nitramide;1,2,5-oxadiazole;2H-tetrazole |
| SMILES | N[N+](=O)[O-].c1cnon1.c1nn[nH]n1 |
| InChI | InChI=1S/C2H2N2O.CH2N4.H2N2O2/c2*1-2-4-5-3-1;1-2(3)4/h1-2H;1H,(H,2,3,4,5);1H2 |
| InChIKey | IWHJMFPGXNRXAE-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 162.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.13 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|