About chloroform;2H-tetrazole
chloroform;2H-tetrazole (PubChem CID 159918626) has the molecular formula C2H3Cl3N4
and a molecular weight of 189.43 g/mol. Its IUPAC name is chloroform;2H-tetrazole.
Molecular Properties
| Compound Name | chloroform;2H-tetrazole |
| PubChem CID | 159918626 |
| Molecular Formula | C2H3Cl3N4 |
| Molecular Weight | 189.43 g/mol |
| Exact Mass | 187.94 |
| IUPAC Name | chloroform;2H-tetrazole |
| SMILES | ClC(Cl)Cl.c1nn[nH]n1 |
| InChI | InChI=1S/CHCl3.CH2N4/c2-1(3)4;1-2-4-5-3-1/h1H;1H,(H,2,3,4,5) |
| InChIKey | NYCOOVPUZHILHV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;2H-tetrazole?
The IUPAC name of chloroform;2H-tetrazole (CID 159918626) is chloroform;2H-tetrazole.
What is the SMILES notation for chloroform;2H-tetrazole?
The canonical SMILES for chloroform;2H-tetrazole is ClC(Cl)Cl.c1nn[nH]n1.
What is the InChIKey of chloroform;2H-tetrazole?
The InChIKey is NYCOOVPUZHILHV-UHFFFAOYSA-N. The full InChI is InChI=1S/CHCl3.CH2N4/c2-1(3)4;1-2-4-5-3-1/h1H;1H,(H,2,3,4,5).
What are the key properties of chloroform;2H-tetrazole?
chloroform;2H-tetrazole has a molecular weight of 189.43 g/mol, XLogP of 1.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;2H-tetrazole is sourced from PubChem (CID 159918626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).