About methyl acetate;2H-tetrazole
methyl acetate;2H-tetrazole (PubChem CID 174965255) has the molecular formula C4H8N4O2
and a molecular weight of 144.13 g/mol. Its IUPAC name is methyl acetate;2H-tetrazole.
Molecular Properties
| Compound Name | methyl acetate;2H-tetrazole |
| PubChem CID | 174965255 |
| Molecular Formula | C4H8N4O2 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | methyl acetate;2H-tetrazole |
| SMILES | COC(C)=O.c1nn[nH]n1 |
| InChI | InChI=1S/C3H6O2.CH2N4/c1-3(4)5-2;1-2-4-5-3-1/h1-2H3;1H,(H,2,3,4,5) |
| InChIKey | QPGKEBDCJGAUGP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl acetate;2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl acetate;2H-tetrazole?
The IUPAC name of methyl acetate;2H-tetrazole (CID 174965255) is methyl acetate;2H-tetrazole.
What is the SMILES notation for methyl acetate;2H-tetrazole?
The canonical SMILES for methyl acetate;2H-tetrazole is COC(C)=O.c1nn[nH]n1.
What is the InChIKey of methyl acetate;2H-tetrazole?
The InChIKey is QPGKEBDCJGAUGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.CH2N4/c1-3(4)5-2;1-2-4-5-3-1/h1-2H3;1H,(H,2,3,4,5).
What are the key properties of methyl acetate;2H-tetrazole?
methyl acetate;2H-tetrazole has a molecular weight of 144.13 g/mol, XLogP of -0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl acetate;2H-tetrazole is sourced from PubChem (CID 174965255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).