C13H18F2N2O3 — CID 139335059
N-[4-(cyclopropylmethylamino)-3,4-dioxobutan-2-yl]-3,3-difluorocyclobutane-1-carboxamide (PubChem CID 139335059) has the molecular formula C13H18F2N2O3 and a molecular weight of 288.29 g/mol. Its IUPAC name is N-[4-(cyclopropylmethylamino)-3,4-dioxobutan-2-yl]-3,3-difluorocyclobutane-1-carboxamide.
| Compound Name | N-[4-(cyclopropylmethylamino)-3,4-dioxobutan-2-yl]-3,3-difluorocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 139335059 |
| Molecular Formula | C13H18F2N2O3 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[4-(cyclopropylmethylamino)-3,4-dioxobutan-2-yl]-3,3-difluorocyclobutane-1-carboxamide |
| SMILES | CC(NC(=O)C1CC(F)(F)C1)C(=O)C(=O)NCC1CC1 |
| InChI | InChI=1S/C13H18F2N2O3/c1-7(10(18)12(20)16-6-8-2-3-8)17-11(19)9-4-13(14,15)5-9/h7-9H,2-6H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | RAEACLVBPRTZOX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|