C16H17BrClNO2 — CID 139335585
tert-butyl N-[1-[2-(3-bromo-4-chlorophenyl)ethynyl]cyclopropyl]carbamate (PubChem CID 139335585) has the molecular formula C16H17BrClNO2 and a molecular weight of 370.67 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(3-bromo-4-chlorophenyl)ethynyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(3-bromo-4-chlorophenyl)ethynyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 139335585 |
| Molecular Formula | C16H17BrClNO2 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | tert-butyl N-[1-[2-(3-bromo-4-chlorophenyl)ethynyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C#Cc2ccc(Cl)c(Br)c2)CC1 |
| InChI | InChI=1S/C16H17BrClNO2/c1-15(2,3)21-14(20)19-16(8-9-16)7-6-11-4-5-13(18)12(17)10-11/h4-5,10H,8-9H2,1-3H3,(H,19,20) |
| InChIKey | MXODOXBDQISKDU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|