C35H35FN4O6 — CID 139336960
(2E,4Z)-N-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-5-(4-fluoro-N-methylanilino)-2-formyl-4-(oxan-4-ylmethyl)penta-2,4-dienamide (PubChem CID 139336960) has the molecular formula C35H35FN4O6 and a molecular weight of 626.69 g/mol. Its IUPAC name is (2E,4Z)-N-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-5-(4-fluoro-N-methylanilino)-2-formyl-4-(oxan-4-ylmethyl)penta-2,4-dienamide.
| Compound Name | (2E,4Z)-N-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-5-(4-fluoro-N-methylanilino)-2-formyl-4-(oxan-4-ylmethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 139336960 |
| Molecular Formula | C35H35FN4O6 |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | (2E,4Z)-N-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-5-(4-fluoro-N-methylanilino)-2-formyl-4-(oxan-4-ylmethyl)penta-2,4-dienamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)/C(C=O)=C/C(=C\N(C)c4ccc(F)cc4)CC4CCOCC4)nc3)c2cc1OC |
| InChI | InChI=1S/C35H35FN4O6/c1-40(27-6-4-26(36)5-7-27)21-24(16-23-11-14-45-15-12-23)17-25(22-41)35(42)39-34-9-8-28(20-38-34)46-31-10-13-37-30-19-33(44-3)32(43-2)18-29(30)31/h4-10,13,17-23H,11-12,14-16H2,1-3H3,(H,38,39,42)/b24-21-,25-17+ |
| InChIKey | USLXOUGQYLZBKR-ZTGDYWFSSA-N |
| XLogP | 6.48 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|