C13H15BrFN7O5S — CID 139339345
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[1-(sulfamoylamino)cyclopropyl]methoxyamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139339345) has the molecular formula C13H15BrFN7O5S and a molecular weight of 480.28 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[1-(sulfamoylamino)cyclopropyl]methoxyamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[1-(sulfamoylamino)cyclopropyl]methoxyamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139339345 |
| Molecular Formula | C13H15BrFN7O5S |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[1-(sulfamoylamino)cyclopropyl]methoxyamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NC1(CONc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)CC1 |
| InChI | InChI=1S/C13H15BrFN7O5S/c14-8-5-7(1-2-9(8)15)17-11(18-23)10-12(21-27-19-10)20-26-6-13(3-4-13)22-28(16,24)25/h1-2,5,22-23H,3-4,6H2,(H,17,18)(H,20,21)(H2,16,24,25) |
| InChIKey | MFIHZBQWIDWORX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 176.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|