C7H12FN — CID 139341015
(3E)-3-fluoro-N-methylhexa-1,3-dien-2-amine (PubChem CID 139341015) has the molecular formula C7H12FN and a molecular weight of 129.18 g/mol. Its IUPAC name is (3E)-3-fluoro-N-methylhexa-1,3-dien-2-amine.
| Compound Name | (3E)-3-fluoro-N-methylhexa-1,3-dien-2-amine |
|---|---|
| PubChem CID | 139341015 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | (3E)-3-fluoro-N-methylhexa-1,3-dien-2-amine |
| SMILES | C=C(NC)/C(F)=C\CC |
| InChI | InChI=1S/C7H12FN/c1-4-5-7(8)6(2)9-3/h5,9H,2,4H2,1,3H3/b7-5+ |
| InChIKey | AYENZESIFHBASU-FNORWQNLSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|