C24H34ClN — CID 139353284
2-butan-2-yl-6-[(3E,5Z,7E)-8-chloro-3,4-dimethylnona-3,5,7-trienyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 139353284) has the molecular formula C24H34ClN and a molecular weight of 372.00 g/mol. Its IUPAC name is 2-butan-2-yl-6-[(3E,5Z,7E)-8-chloro-3,4-dimethylnona-3,5,7-trienyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-butan-2-yl-6-[(3E,5Z,7E)-8-chloro-3,4-dimethylnona-3,5,7-trienyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 139353284 |
| Molecular Formula | C24H34ClN |
| Molecular Weight | 372.00 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 2-butan-2-yl-6-[(3E,5Z,7E)-8-chloro-3,4-dimethylnona-3,5,7-trienyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | CCC(C)N1CCc2cc(CC/C(C)=C(C)/C=C\C=C(/C)Cl)ccc2C1 |
| InChI | InChI=1S/C24H34ClN/c1-6-21(5)26-15-14-23-16-22(12-13-24(23)17-26)11-10-19(3)18(2)8-7-9-20(4)25/h7-9,12-13,16,21H,6,10-11,14-15,17H2,1-5H3/b8-7-,19-18+,20-9+ |
| InChIKey | CHTBGWHWTLGURT-DQNFKEAOSA-N |
| XLogP | 6.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.00 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|