C7H15NO3S — CID 139354363
[(1R,3S)-3-methylcyclopentyl]methyl sulfamate (PubChem CID 139354363) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is [(1R,3S)-3-methylcyclopentyl]methyl sulfamate.
| Compound Name | [(1R,3S)-3-methylcyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 139354363 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | [(1R,3S)-3-methylcyclopentyl]methyl sulfamate |
| SMILES | C[C@H]1CC[C@@H](COS(N)(=O)=O)C1 |
| InChI | InChI=1S/C7H15NO3S/c1-6-2-3-7(4-6)5-11-12(8,9)10/h6-7H,2-5H2,1H3,(H2,8,9,10)/t6-,7+/m0/s1 |
| InChIKey | KLXUNEFVLOYKBA-NKWVEPMBSA-N |
| XLogP | 0.64 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |