C16H25ClN4O3 — CID 139356140
1-(2-chloro-4-pyridinyl)-3-[(1R,3S)-3-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]cyclopentyl]urea (PubChem CID 139356140) has the molecular formula C16H25ClN4O3 and a molecular weight of 356.85 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)-3-[(1R,3S)-3-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]cyclopentyl]urea.
| Compound Name | 1-(2-chloro-4-pyridinyl)-3-[(1R,3S)-3-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]cyclopentyl]urea |
|---|---|
| PubChem CID | 139356140 |
| Molecular Formula | C16H25ClN4O3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)-3-[(1R,3S)-3-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]cyclopentyl]urea |
| SMILES | CC(C)(C)OC(O)N[C@H]1CC[C@@H](NC(=O)Nc2ccnc(Cl)c2)C1 |
| InChI | InChI=1S/C16H25ClN4O3/c1-16(2,3)24-15(23)21-11-5-4-10(8-11)19-14(22)20-12-6-7-18-13(17)9-12/h6-7,9-11,15,21,23H,4-5,8H2,1-3H3,(H2,18,19,20,22)/t10-,11+,15?/m1/s1 |
| InChIKey | SDYJGLNELTVTAS-SPJRPDJQSA-N |
| XLogP | 2.46 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|