C28H33F4N3O3S — CID 139362505
tert-butyl N-[3-[3-[[8-fluoro-3-(trifluoromethyl)-10H-phenothiazin-1-yl]carbamoyl]cyclohexyl]propyl]carbamate (PubChem CID 139362505) has the molecular formula C28H33F4N3O3S and a molecular weight of 567.65 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[8-fluoro-3-(trifluoromethyl)-10H-phenothiazin-1-yl]carbamoyl]cyclohexyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[8-fluoro-3-(trifluoromethyl)-10H-phenothiazin-1-yl]carbamoyl]cyclohexyl]propyl]carbamate |
|---|---|
| PubChem CID | 139362505 |
| Molecular Formula | C28H33F4N3O3S |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | tert-butyl N-[3-[3-[[8-fluoro-3-(trifluoromethyl)-10H-phenothiazin-1-yl]carbamoyl]cyclohexyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC1CCCC(C(=O)Nc2cc(C(F)(F)F)cc3c2Nc2cc(F)ccc2S3)C1 |
| InChI | InChI=1S/C28H33F4N3O3S/c1-27(2,3)38-26(37)33-11-5-7-16-6-4-8-17(12-16)25(36)35-21-13-18(28(30,31)32)14-23-24(21)34-20-15-19(29)9-10-22(20)39-23/h9-10,13-17,34H,4-8,11-12H2,1-3H3,(H,33,37)(H,35,36) |
| InChIKey | YPSLCKROTITMNG-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|