C28H36F3N3O2S — CID 139362536
tert-butyl N-[3-[3-[[[3-(trifluoromethyl)-10H-phenothiazin-1-yl]amino]methyl]cyclohexyl]propyl]carbamate (PubChem CID 139362536) has the molecular formula C28H36F3N3O2S and a molecular weight of 535.68 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[[3-(trifluoromethyl)-10H-phenothiazin-1-yl]amino]methyl]cyclohexyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[[3-(trifluoromethyl)-10H-phenothiazin-1-yl]amino]methyl]cyclohexyl]propyl]carbamate |
|---|---|
| PubChem CID | 139362536 |
| Molecular Formula | C28H36F3N3O2S |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | tert-butyl N-[3-[3-[[[3-(trifluoromethyl)-10H-phenothiazin-1-yl]amino]methyl]cyclohexyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC1CCCC(CNc2cc(C(F)(F)F)cc3c2Nc2ccccc2S3)C1 |
| InChI | InChI=1S/C28H36F3N3O2S/c1-27(2,3)36-26(35)32-13-7-10-18-8-6-9-19(14-18)17-33-22-15-20(28(29,30)31)16-24-25(22)34-21-11-4-5-12-23(21)37-24/h4-5,11-12,15-16,18-19,33-34H,6-10,13-14,17H2,1-3H3,(H,32,35) |
| InChIKey | FBGYQRBTCAXLKH-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|