C13H16N2O5S — CID 139367483
benzyl 3-(methylsulfonylcarbamoyl)azetidine-1-carboxylate (PubChem CID 139367483) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is benzyl 3-(methylsulfonylcarbamoyl)azetidine-1-carboxylate.
| Compound Name | benzyl 3-(methylsulfonylcarbamoyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 139367483 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | benzyl 3-(methylsulfonylcarbamoyl)azetidine-1-carboxylate |
| SMILES | CS(=O)(=O)NC(=O)C1CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C13H16N2O5S/c1-21(18,19)14-12(16)11-7-15(8-11)13(17)20-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,14,16) |
| InChIKey | XYSKIWFKDXQBFC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |