C20H16FNO5S2 — CID 139368811
5-[(3-fluorophenyl)sulfamoyl]-2-(4-methoxyphenyl)sulfanylbenzoic acid (PubChem CID 139368811) has the molecular formula C20H16FNO5S2 and a molecular weight of 433.48 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)sulfamoyl]-2-(4-methoxyphenyl)sulfanylbenzoic acid.
| Compound Name | 5-[(3-fluorophenyl)sulfamoyl]-2-(4-methoxyphenyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 139368811 |
| Molecular Formula | C20H16FNO5S2 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 5-[(3-fluorophenyl)sulfamoyl]-2-(4-methoxyphenyl)sulfanylbenzoic acid |
| SMILES | COc1ccc(Sc2ccc(S(=O)(=O)Nc3cccc(F)c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C20H16FNO5S2/c1-27-15-5-7-16(8-6-15)28-19-10-9-17(12-18(19)20(23)24)29(25,26)22-14-4-2-3-13(21)11-14/h2-12,22H,1H3,(H,23,24) |
| InChIKey | CENRKATUCBFTKY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |