About 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial
2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial (PubChem CID 139372207) has the molecular formula C7H12N2S
and a molecular weight of 156.25 g/mol. Its IUPAC name is 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial.
Molecular Properties
| Compound Name | 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial |
| PubChem CID | 139372207 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial |
| SMILES | CC(C=S)C1=NCCN1C |
| InChI | InChI=1S/C7H12N2S/c1-6(5-10)7-8-3-4-9(7)2/h5-6H,3-4H2,1-2H3 |
| InChIKey | IJMVAVPLZLQTPQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial?
The IUPAC name of 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial (CID 139372207) is 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial.
What is the SMILES notation for 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial?
The canonical SMILES for 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial is CC(C=S)C1=NCCN1C.
What is the InChIKey of 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial?
The InChIKey is IJMVAVPLZLQTPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2S/c1-6(5-10)7-8-3-4-9(7)2/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial?
2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial has a molecular weight of 156.25 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-4,5-dihydroimidazol-2-yl)propanethial is sourced from PubChem (CID 139372207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).