C7H12N2S2 — CID 15400895
2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)ethanedithioate (PubChem CID 15400895) has the molecular formula C7H12N2S2 and a molecular weight of 188.32 g/mol. Its IUPAC name is 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)ethanedithioate.
| Compound Name | 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)ethanedithioate |
|---|---|
| PubChem CID | 15400895 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)ethanedithioate |
| SMILES | CN1CC[N+](C)=C1CC(=S)[S-] |
| InChI | InChI=1S/C7H12N2S2/c1-8-3-4-9(2)6(8)5-7(10)11/h3-5H2,1-2H3 |
| InChIKey | HWOJBUAGSBRAMZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|