C23H24FN3 — CID 139374599
(2Z,4E)-4-N-[1-(3-fluorophenyl)-2-(1H-indol-3-yl)prop-2-enyl]hexa-2,4-diene-2,4-diamine (PubChem CID 139374599) has the molecular formula C23H24FN3 and a molecular weight of 361.46 g/mol. Its IUPAC name is (2Z,4E)-4-N-[1-(3-fluorophenyl)-2-(1H-indol-3-yl)prop-2-enyl]hexa-2,4-diene-2,4-diamine.
| Compound Name | (2Z,4E)-4-N-[1-(3-fluorophenyl)-2-(1H-indol-3-yl)prop-2-enyl]hexa-2,4-diene-2,4-diamine |
|---|---|
| PubChem CID | 139374599 |
| Molecular Formula | C23H24FN3 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (2Z,4E)-4-N-[1-(3-fluorophenyl)-2-(1H-indol-3-yl)prop-2-enyl]hexa-2,4-diene-2,4-diamine |
| SMILES | C=C(c1c[nH]c2ccccc12)C(NC(/C=C(/C)N)=C/C)c1cccc(F)c1 |
| InChI | InChI=1S/C23H24FN3/c1-4-19(12-15(2)25)27-23(17-8-7-9-18(24)13-17)16(3)21-14-26-22-11-6-5-10-20(21)22/h4-14,23,26-27H,3,25H2,1-2H3/b15-12-,19-4+ |
| InChIKey | QSOFCKRBOQROQF-UCDHIWJNSA-N |
| XLogP | 5.42 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|