C18H22F3N3O5 — CID 139375926
oxolan-2-ylmethyl 4-[4-amino-3-(trifluoromethoxy)benzoyl]piperazine-1-carboxylate (PubChem CID 139375926) has the molecular formula C18H22F3N3O5 and a molecular weight of 417.38 g/mol. Its IUPAC name is oxolan-2-ylmethyl 4-[4-amino-3-(trifluoromethoxy)benzoyl]piperazine-1-carboxylate.
| Compound Name | oxolan-2-ylmethyl 4-[4-amino-3-(trifluoromethoxy)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139375926 |
| Molecular Formula | C18H22F3N3O5 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | oxolan-2-ylmethyl 4-[4-amino-3-(trifluoromethoxy)benzoyl]piperazine-1-carboxylate |
| SMILES | Nc1ccc(C(=O)N2CCN(C(=O)OCC3CCCO3)CC2)cc1OC(F)(F)F |
| InChI | InChI=1S/C18H22F3N3O5/c19-18(20,21)29-15-10-12(3-4-14(15)22)16(25)23-5-7-24(8-6-23)17(26)28-11-13-2-1-9-27-13/h3-4,10,13H,1-2,5-9,11,22H2 |
| InChIKey | FHIOWGKJROVELD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|