C16H21F3O — CID 139376251
[(E,3R,4R)-4-(trifluoromethyl)oct-6-en-3-yl]oxymethylbenzene (PubChem CID 139376251) has the molecular formula C16H21F3O and a molecular weight of 286.34 g/mol. Its IUPAC name is [(E,3R,4R)-4-(trifluoromethyl)oct-6-en-3-yl]oxymethylbenzene.
| Compound Name | [(E,3R,4R)-4-(trifluoromethyl)oct-6-en-3-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 139376251 |
| Molecular Formula | C16H21F3O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [(E,3R,4R)-4-(trifluoromethyl)oct-6-en-3-yl]oxymethylbenzene |
| SMILES | C/C=C/C[C@H]([C@@H](CC)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H21F3O/c1-3-5-11-14(16(17,18)19)15(4-2)20-12-13-9-7-6-8-10-13/h3,5-10,14-15H,4,11-12H2,1-2H3/b5-3+/t14-,15-/m1/s1 |
| InChIKey | PUMIMCHWAYNMFL-UJOCRUBTSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|