C19H12F5NO — CID 139386250
2,3-difluoro-4-[4-[(3,4,5-trifluorophenoxy)methyl]phenyl]aniline (PubChem CID 139386250) has the molecular formula C19H12F5NO and a molecular weight of 365.30 g/mol. Its IUPAC name is 2,3-difluoro-4-[4-[(3,4,5-trifluorophenoxy)methyl]phenyl]aniline.
| Compound Name | 2,3-difluoro-4-[4-[(3,4,5-trifluorophenoxy)methyl]phenyl]aniline |
|---|---|
| PubChem CID | 139386250 |
| Molecular Formula | C19H12F5NO |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 2,3-difluoro-4-[4-[(3,4,5-trifluorophenoxy)methyl]phenyl]aniline |
| SMILES | Nc1ccc(-c2ccc(COc3cc(F)c(F)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C19H12F5NO/c20-14-7-12(8-15(21)18(14)23)26-9-10-1-3-11(4-2-10)13-5-6-16(25)19(24)17(13)22/h1-8H,9,25H2 |
| InChIKey | HHWWHOQCKURQFE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|