C25H22F5NO — CID 139386286
4-[2,3-difluoro-4-[4-[(3,4,5-trifluorophenoxy)methyl]phenyl]phenyl]cyclohexan-1-amine (PubChem CID 139386286) has the molecular formula C25H22F5NO and a molecular weight of 447.45 g/mol. Its IUPAC name is 4-[2,3-difluoro-4-[4-[(3,4,5-trifluorophenoxy)methyl]phenyl]phenyl]cyclohexan-1-amine.
| Compound Name | 4-[2,3-difluoro-4-[4-[(3,4,5-trifluorophenoxy)methyl]phenyl]phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 139386286 |
| Molecular Formula | C25H22F5NO |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-[2,3-difluoro-4-[4-[(3,4,5-trifluorophenoxy)methyl]phenyl]phenyl]cyclohexan-1-amine |
| SMILES | NC1CCC(c2ccc(-c3ccc(COc4cc(F)c(F)c(F)c4)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C25H22F5NO/c26-21-11-18(12-22(27)25(21)30)32-13-14-1-3-15(4-2-14)19-9-10-20(24(29)23(19)28)16-5-7-17(31)8-6-16/h1-4,9-12,16-17H,5-8,13,31H2 |
| InChIKey | DOJCXMHTJZRFPC-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|