C18H20ClN7O2 — CID 139387421
(E,4E)-4-chloro-4-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)-2-(7H-purin-6-ylamino)but-2-enal (PubChem CID 139387421) has the molecular formula C18H20ClN7O2 and a molecular weight of 401.86 g/mol. Its IUPAC name is (E,4E)-4-chloro-4-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)-2-(7H-purin-6-ylamino)but-2-enal.
| Compound Name | (E,4E)-4-chloro-4-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)-2-(7H-purin-6-ylamino)but-2-enal |
|---|---|
| PubChem CID | 139387421 |
| Molecular Formula | C18H20ClN7O2 |
| Molecular Weight | 401.86 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (E,4E)-4-chloro-4-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)-2-(7H-purin-6-ylamino)but-2-enal |
| SMILES | CN1/C(=C(Cl)\C=C(/C=O)Nc2ncnc3nc[nH]c23)C(=O)NC12CCCCC2 |
| InChI | InChI=1S/C18H20ClN7O2/c1-26-14(17(28)25-18(26)5-3-2-4-6-18)12(19)7-11(8-27)24-16-13-15(21-9-20-13)22-10-23-16/h7-10H,2-6H2,1H3,(H,25,28)(H2,20,21,22,23,24)/b11-7+,14-12+ |
| InChIKey | GHNQOVJBCQWMEQ-OXDGOREKSA-N |
| XLogP | 2.02 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.86 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|