C15H16ClFN2O — CID 139387815
1-(7-chloro-6-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propan-1-one (PubChem CID 139387815) has the molecular formula C15H16ClFN2O and a molecular weight of 294.76 g/mol. Its IUPAC name is 1-(7-chloro-6-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propan-1-one.
| Compound Name | 1-(7-chloro-6-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 139387815 |
| Molecular Formula | C15H16ClFN2O |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(7-chloro-6-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propan-1-one |
| SMILES | CCC(=O)N1CCc2c(c3ccc(Cl)c(F)c3n2C)C1 |
| InChI | InChI=1S/C15H16ClFN2O/c1-3-13(20)19-7-6-12-10(8-19)9-4-5-11(16)14(17)15(9)18(12)2/h4-5H,3,6-8H2,1-2H3 |
| InChIKey | KHWLYERDLFWIAC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|