C34H40ClFN6O4 — CID 167849295
tert-butyl (4R,5R)-4-[1-[2-[3-(7-chloro-6-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-3-oxopropyl]phenyl]triazol-4-yl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 167849295) has the molecular formula C34H40ClFN6O4 and a molecular weight of 651.18 g/mol. Its IUPAC name is tert-butyl (4R,5R)-4-[1-[2-[3-(7-chloro-6-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-3-oxopropyl]phenyl]triazol-4-yl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5R)-4-[1-[2-[3-(7-chloro-6-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-3-oxopropyl]phenyl]triazol-4-yl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 167849295 |
| Molecular Formula | C34H40ClFN6O4 |
| Molecular Weight | 651.18 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | tert-butyl (4R,5R)-4-[1-[2-[3-(7-chloro-6-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-3-oxopropyl]phenyl]triazol-4-yl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1c1cn(-c2ccccc2CCC(=O)N2CCc3c(c4ccc(Cl)c(F)c4n3C)C2)nn1 |
| InChI | InChI=1S/C34H40ClFN6O4/c1-20-30(42(34(5,6)45-20)32(44)46-33(2,3)4)25-19-41(38-37-25)26-11-9-8-10-21(26)12-15-28(43)40-17-16-27-23(18-40)22-13-14-24(35)29(36)31(22)39(27)7/h8-11,13-14,19-20,30H,12,15-18H2,1-7H3/t20-,30+/m1/s1 |
| InChIKey | LHCMWFXTOKDQOT-KEEVHDRGSA-N |
| XLogP | 6.50 |
| TPSA | 94.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.18 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|