C7H9ClO4 — CID 139394075
[(6E)-5,8-dihydro-4H-1,3-dioxocin-5-yl] carbonochloridate (PubChem CID 139394075) has the molecular formula C7H9ClO4 and a molecular weight of 192.60 g/mol. Its IUPAC name is [(6E)-5,8-dihydro-4H-1,3-dioxocin-5-yl] carbonochloridate.
| Compound Name | [(6E)-5,8-dihydro-4H-1,3-dioxocin-5-yl] carbonochloridate |
|---|---|
| PubChem CID | 139394075 |
| Molecular Formula | C7H9ClO4 |
| Molecular Weight | 192.60 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | [(6E)-5,8-dihydro-4H-1,3-dioxocin-5-yl] carbonochloridate |
| SMILES | O=C(Cl)OC1/C=C\COCOC1 |
| InChI | InChI=1S/C7H9ClO4/c8-7(9)12-6-2-1-3-10-5-11-4-6/h1-2,6H,3-5H2/b2-1- |
| InChIKey | MSLGTDVOVUKXSW-UPHRSURJSA-N |
| XLogP | 1.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.60 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|