C7H8ClNO4 — CID 118370215
[4-(dihydroxyamino)cyclohexa-2,4-dien-1-yl] carbonochloridate (PubChem CID 118370215) has the molecular formula C7H8ClNO4 and a molecular weight of 205.60 g/mol. Its IUPAC name is [4-(dihydroxyamino)cyclohexa-2,4-dien-1-yl] carbonochloridate.
| Compound Name | [4-(dihydroxyamino)cyclohexa-2,4-dien-1-yl] carbonochloridate |
|---|---|
| PubChem CID | 118370215 |
| Molecular Formula | C7H8ClNO4 |
| Molecular Weight | 205.60 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | [4-(dihydroxyamino)cyclohexa-2,4-dien-1-yl] carbonochloridate |
| SMILES | O=C(Cl)OC1C=CC(N(O)O)=CC1 |
| InChI | InChI=1S/C7H8ClNO4/c8-7(10)13-6-3-1-5(2-4-6)9(11)12/h1-3,6,11-12H,4H2 |
| InChIKey | MWGMGDHAELWCAI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.60 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|