C19H28N4 — CID 139398825
(Z)-N'-[4-(3,4-dihydropyridin-3-yl)cyclohexa-2,4-dien-1-yl]-2-ethyl-3-(methylamino)pent-2-enimidamide (PubChem CID 139398825) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is (Z)-N'-[4-(3,4-dihydropyridin-3-yl)cyclohexa-2,4-dien-1-yl]-2-ethyl-3-(methylamino)pent-2-enimidamide.
| Compound Name | (Z)-N'-[4-(3,4-dihydropyridin-3-yl)cyclohexa-2,4-dien-1-yl]-2-ethyl-3-(methylamino)pent-2-enimidamide |
|---|---|
| PubChem CID | 139398825 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (Z)-N'-[4-(3,4-dihydropyridin-3-yl)cyclohexa-2,4-dien-1-yl]-2-ethyl-3-(methylamino)pent-2-enimidamide |
| SMILES | CC/C(NC)=C(CC)/C(N)=N/C1C=CC(C2C=NC=CC2)=CC1 |
| InChI | InChI=1S/C19H28N4/c1-4-17(18(5-2)21-3)19(20)23-16-10-8-14(9-11-16)15-7-6-12-22-13-15/h6,8-10,12-13,15-16,21H,4-5,7,11H2,1-3H3,(H2,20,23)/b18-17- |
| InChIKey | GEYJETOQHLYSMZ-ZCXUNETKSA-N |
| XLogP | 3.50 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|