C21H31N5O — CID 139399050
1-formyl-N'-(3-methylphenyl)-4-[(1-methylpiperidin-3-yl)methylamino]-3,6-dihydro-2H-pyridine-5-carboximidamide (PubChem CID 139399050) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-formyl-N'-(3-methylphenyl)-4-[(1-methylpiperidin-3-yl)methylamino]-3,6-dihydro-2H-pyridine-5-carboximidamide.
| Compound Name | 1-formyl-N'-(3-methylphenyl)-4-[(1-methylpiperidin-3-yl)methylamino]-3,6-dihydro-2H-pyridine-5-carboximidamide |
|---|---|
| PubChem CID | 139399050 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 1-formyl-N'-(3-methylphenyl)-4-[(1-methylpiperidin-3-yl)methylamino]-3,6-dihydro-2H-pyridine-5-carboximidamide |
| SMILES | Cc1cccc(/N=C(\N)C2=C(NCC3CCCN(C)C3)CCN(C=O)C2)c1 |
| InChI | InChI=1S/C21H31N5O/c1-16-5-3-7-18(11-16)24-21(22)19-14-26(15-27)10-8-20(19)23-12-17-6-4-9-25(2)13-17/h3,5,7,11,15,17,23H,4,6,8-10,12-14H2,1-2H3,(H2,22,24) |
| InChIKey | MNFAWJKFUUTFAY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|