C27H46O4 — CID 139401217
(5S,8R,9S,10S,13R,14S,17R)-17-[(2R)-4-(3-hydroxyoxolan-3-yl)butan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,3-diol (PubChem CID 139401217) has the molecular formula C27H46O4 and a molecular weight of 434.66 g/mol. Its IUPAC name is (5S,8R,9S,10S,13R,14S,17R)-17-[(2R)-4-(3-hydroxyoxolan-3-yl)butan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,3-diol.
| Compound Name | (5S,8R,9S,10S,13R,14S,17R)-17-[(2R)-4-(3-hydroxyoxolan-3-yl)butan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,3-diol |
|---|---|
| PubChem CID | 139401217 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | (5S,8R,9S,10S,13R,14S,17R)-17-[(2R)-4-(3-hydroxyoxolan-3-yl)butan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,3-diol |
| SMILES | C[C@H](CCC1(O)CCOC1)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(O)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H46O4/c1-18(8-11-26(28)14-15-31-17-26)21-6-7-22-20-5-4-19-16-27(29,30)13-12-24(19,2)23(20)9-10-25(21,22)3/h18-23,28-30H,4-17H2,1-3H3/t18-,19+,20+,21-,22+,23+,24+,25-,26?/m1/s1 |
| InChIKey | XYFPQGNTFZGNPT-MZSYAJQJSA-N |
| XLogP | 4.89 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|