C25H43NO3 — CID 142274697
4-(3,3-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-N-methylpentanamide (PubChem CID 142274697) has the molecular formula C25H43NO3 and a molecular weight of 405.62 g/mol. Its IUPAC name is 4-(3,3-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-N-methylpentanamide.
| Compound Name | 4-(3,3-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-N-methylpentanamide |
|---|---|
| PubChem CID | 142274697 |
| Molecular Formula | C25H43NO3 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | 4-(3,3-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-N-methylpentanamide |
| SMILES | CNC(=O)CCC(C)C1CCC2C3CCC4CC(O)(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H43NO3/c1-16(5-10-22(27)26-4)19-8-9-20-18-7-6-17-15-25(28,29)14-13-23(17,2)21(18)11-12-24(19,20)3/h16-21,28-29H,5-15H2,1-4H3,(H,26,27) |
| InChIKey | HJYADHGTTQCSDQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|