C19H20N2O6 — CID 139401672
methyl 2-[[4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]benzoyl]amino]-3-hydroxybutanoate (PubChem CID 139401672) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is methyl 2-[[4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]benzoyl]amino]-3-hydroxybutanoate.
| Compound Name | methyl 2-[[4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]benzoyl]amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 139401672 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | methyl 2-[[4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]benzoyl]amino]-3-hydroxybutanoate |
| SMILES | COC(=O)C(NC(=O)c1ccc(NC(=O)/C=C/c2ccco2)cc1)C(C)O |
| InChI | InChI=1S/C19H20N2O6/c1-12(22)17(19(25)26-2)21-18(24)13-5-7-14(8-6-13)20-16(23)10-9-15-4-3-11-27-15/h3-12,17,22H,1-2H3,(H,20,23)(H,21,24)/b10-9+ |
| InChIKey | MGMKDUZDGDOZCN-MDZDMXLPSA-N |
| XLogP | 1.58 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|