C22H34O4 — CID 139404903
5-[(6Z)-6-[(4E)-cyclooct-4-en-1-yl]-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]pentanoic acid (PubChem CID 139404903) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 5-[(6Z)-6-[(4E)-cyclooct-4-en-1-yl]-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]pentanoic acid.
| Compound Name | 5-[(6Z)-6-[(4E)-cyclooct-4-en-1-yl]-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 139404903 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 5-[(6Z)-6-[(4E)-cyclooct-4-en-1-yl]-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCC1OC2CC/C=C(/C3CC/C=C\CCC3)CCC2O1 |
| InChI | InChI=1S/C22H34O4/c23-21(24)13-6-7-14-22-25-19-12-8-11-18(15-16-20(19)26-22)17-9-4-2-1-3-5-10-17/h1-2,11,17,19-20,22H,3-10,12-16H2,(H,23,24)/b2-1-,18-11+ |
| InChIKey | ONLVDEUDKLELTC-IGFLTATQSA-N |
| XLogP | 5.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|